C20H15ClN2O4S2 — CID 3142984
3-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-chlorophenyl)propanamide (PubChem CID 3142984) has the molecular formula C20H15ClN2O4S2 and a molecular weight of 446.94 g/mol. Its IUPAC name is 3-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-chlorophenyl)propanamide.
| Compound Name | 3-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-chlorophenyl)propanamide |
|---|---|
| PubChem CID | 3142984 |
| Molecular Formula | C20H15ClN2O4S2 |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | 3-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-chlorophenyl)propanamide |
| SMILES | O=C(CCN1C(=O)C(=Cc2ccc3c(c2)OCO3)SC1=S)Nc1ccccc1Cl |
| InChI | InChI=1S/C20H15ClN2O4S2/c21-13-3-1-2-4-14(13)22-18(24)7-8-23-19(25)17(29-20(23)28)10-12-5-6-15-16(9-12)27-11-26-15/h1-6,9-10H,7-8,11H2,(H,22,24) |
| InChIKey | PLRPMSASYKDRMR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|