C20H15FN2O4S2 — CID 6202135
N-(1,3-benzodioxol-5-yl)-3-[(5Z)-5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide (PubChem CID 6202135) has the molecular formula C20H15FN2O4S2 and a molecular weight of 430.48 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-[(5Z)-5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-[(5Z)-5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 6202135 |
| Molecular Formula | C20H15FN2O4S2 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-[(5Z)-5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
| SMILES | O=C(CCN1C(=O)/C(=C/c2ccccc2F)SC1=S)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H15FN2O4S2/c21-14-4-2-1-3-12(14)9-17-19(25)23(20(28)29-17)8-7-18(24)22-13-5-6-15-16(10-13)27-11-26-15/h1-6,9-10H,7-8,11H2,(H,22,24)/b17-9- |
| InChIKey | NHKCQLDGAMRPSJ-MFOYZWKCSA-N |
| XLogP | 3.78 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|