C20H15ClF2N2O2S3 — CID 2309165
3-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[4-(difluoromethylsulfanyl)phenyl]propanamide (PubChem CID 2309165) has the molecular formula C20H15ClF2N2O2S3 and a molecular weight of 485.00 g/mol. Its IUPAC name is 3-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[4-(difluoromethylsulfanyl)phenyl]propanamide.
| Compound Name | 3-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[4-(difluoromethylsulfanyl)phenyl]propanamide |
|---|---|
| PubChem CID | 2309165 |
| Molecular Formula | C20H15ClF2N2O2S3 |
| Molecular Weight | 485.00 g/mol |
| Exact Mass | 484.00 |
| IUPAC Name | 3-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[4-(difluoromethylsulfanyl)phenyl]propanamide |
| SMILES | O=C(CCN1C(=O)/C(=C/c2ccccc2Cl)SC1=S)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C20H15ClF2N2O2S3/c21-15-4-2-1-3-12(15)11-16-18(27)25(20(28)30-16)10-9-17(26)24-13-5-7-14(8-6-13)29-19(22)23/h1-8,11,19H,9-10H2,(H,24,26)/b16-11- |
| InChIKey | OLZLRIVMUQMLCM-WJDWOHSUSA-N |
| XLogP | 5.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.00 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|