C20H15Cl2N3O4S2 — CID 16630428
4-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-nitrophenyl)butanamide (PubChem CID 16630428) has the molecular formula C20H15Cl2N3O4S2 and a molecular weight of 496.40 g/mol. Its IUPAC name is 4-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-nitrophenyl)butanamide.
| Compound Name | 4-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 16630428 |
| Molecular Formula | C20H15Cl2N3O4S2 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 494.99 |
| IUPAC Name | 4-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-nitrophenyl)butanamide |
| SMILES | O=C(CCCN1C(=O)/C(=C/c2cccc(Cl)c2Cl)SC1=S)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H15Cl2N3O4S2/c21-15-4-1-3-12(18(15)22)11-16-19(27)24(20(30)31-16)10-2-5-17(26)23-13-6-8-14(9-7-13)25(28)29/h1,3-4,6-9,11H,2,5,10H2,(H,23,26)/b16-11- |
| InChIKey | NUYIREXFJFFFTI-WJDWOHSUSA-N |
| XLogP | 5.52 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|