C26H21N3O5S2 — CID 16630426
N-(4-nitrophenyl)-4-[(5Z)-4-oxo-5-[(3-phenoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide (PubChem CID 16630426) has the molecular formula C26H21N3O5S2 and a molecular weight of 519.60 g/mol. Its IUPAC name is N-(4-nitrophenyl)-4-[(5Z)-4-oxo-5-[(3-phenoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | N-(4-nitrophenyl)-4-[(5Z)-4-oxo-5-[(3-phenoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 16630426 |
| Molecular Formula | C26H21N3O5S2 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | N-(4-nitrophenyl)-4-[(5Z)-4-oxo-5-[(3-phenoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
| SMILES | O=C(CCCN1C(=O)/C(=C/c2cccc(Oc3ccccc3)c2)SC1=S)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H21N3O5S2/c30-24(27-19-11-13-20(14-12-19)29(32)33)10-5-15-28-25(31)23(36-26(28)35)17-18-6-4-9-22(16-18)34-21-7-2-1-3-8-21/h1-4,6-9,11-14,16-17H,5,10,15H2,(H,27,30)/b23-17- |
| InChIKey | RAIMDYBMPQIPQK-QJOMJCCJSA-N |
| XLogP | 6.01 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|