C20H16ClN5O6S2 — CID 3637162
4-[5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N'-(2,4-dinitrophenyl)butanehydrazide (PubChem CID 3637162) has the molecular formula C20H16ClN5O6S2 and a molecular weight of 521.96 g/mol. Its IUPAC name is 4-[5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N'-(2,4-dinitrophenyl)butanehydrazide.
| Compound Name | 4-[5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N'-(2,4-dinitrophenyl)butanehydrazide |
|---|---|
| PubChem CID | 3637162 |
| Molecular Formula | C20H16ClN5O6S2 |
| Molecular Weight | 521.96 g/mol |
| Exact Mass | 521.02 |
| IUPAC Name | 4-[5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N'-(2,4-dinitrophenyl)butanehydrazide |
| SMILES | O=C(CCCN1C(=O)C(=Cc2ccccc2Cl)SC1=S)NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16ClN5O6S2/c21-14-5-2-1-4-12(14)10-17-19(28)24(20(33)34-17)9-3-6-18(27)23-22-15-8-7-13(25(29)30)11-16(15)26(31)32/h1-2,4-5,7-8,10-11,22H,3,6,9H2,(H,23,27) |
| InChIKey | CFRKPGMFLMPZKI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 147.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.96 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|