C23H21N5O6S2 — CID 4760375
N'-(2,4-dinitrophenyl)-4-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanehydrazide (PubChem CID 4760375) has the molecular formula C23H21N5O6S2 and a molecular weight of 527.58 g/mol. Its IUPAC name is N'-(2,4-dinitrophenyl)-4-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanehydrazide.
| Compound Name | N'-(2,4-dinitrophenyl)-4-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanehydrazide |
|---|---|
| PubChem CID | 4760375 |
| Molecular Formula | C23H21N5O6S2 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | N'-(2,4-dinitrophenyl)-4-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanehydrazide |
| SMILES | CC(=Cc1ccccc1)C=C1SC(=S)N(CCCC(=O)NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C23H21N5O6S2/c1-15(12-16-6-3-2-4-7-16)13-20-22(30)26(23(35)36-20)11-5-8-21(29)25-24-18-10-9-17(27(31)32)14-19(18)28(33)34/h2-4,6-7,9-10,12-14,24H,5,8,11H2,1H3,(H,25,29) |
| InChIKey | CSUKHMKERRVXNS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 147.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|