C22H21N5O6S2 — CID 6202311
N'-(2,4-dinitrophenyl)-4-[(5Z)-5-[(4-ethylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanehydrazide (PubChem CID 6202311) has the molecular formula C22H21N5O6S2 and a molecular weight of 515.57 g/mol. Its IUPAC name is N'-(2,4-dinitrophenyl)-4-[(5Z)-5-[(4-ethylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanehydrazide.
| Compound Name | N'-(2,4-dinitrophenyl)-4-[(5Z)-5-[(4-ethylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanehydrazide |
|---|---|
| PubChem CID | 6202311 |
| Molecular Formula | C22H21N5O6S2 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | N'-(2,4-dinitrophenyl)-4-[(5Z)-5-[(4-ethylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanehydrazide |
| SMILES | CCc1ccc(/C=C2\SC(=S)N(CCCC(=O)NNc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])C2=O)cc1 |
| InChI | InChI=1S/C22H21N5O6S2/c1-2-14-5-7-15(8-6-14)12-19-21(29)25(22(34)35-19)11-3-4-20(28)24-23-17-10-9-16(26(30)31)13-18(17)27(32)33/h5-10,12-13,23H,2-4,11H2,1H3,(H,24,28)/b19-12- |
| InChIKey | ZOVCUPCQOBQHPQ-UNOMPAQXSA-N |
| XLogP | 4.19 |
| TPSA | 147.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|