C25H28N2O2S2 — CID 4529574
4-[5-[(4-ethylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)butanamide (PubChem CID 4529574) has the molecular formula C25H28N2O2S2 and a molecular weight of 452.65 g/mol. Its IUPAC name is 4-[5-[(4-ethylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)butanamide.
| Compound Name | 4-[5-[(4-ethylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)butanamide |
|---|---|
| PubChem CID | 4529574 |
| Molecular Formula | C25H28N2O2S2 |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 4-[5-[(4-ethylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)butanamide |
| SMILES | CCc1ccc(C=C2SC(=S)N(CCCC(=O)Nc3c(C)cc(C)cc3C)C2=O)cc1 |
| InChI | InChI=1S/C25H28N2O2S2/c1-5-19-8-10-20(11-9-19)15-21-24(29)27(25(30)31-21)12-6-7-22(28)26-23-17(3)13-16(2)14-18(23)4/h8-11,13-15H,5-7,12H2,1-4H3,(H,26,28) |
| InChIKey | QFNPJDHSVYTVCV-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|