C23H24N2O2S2 — CID 3428517
3-[5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)propanamide (PubChem CID 3428517) has the molecular formula C23H24N2O2S2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 3-[5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)propanamide.
| Compound Name | 3-[5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)propanamide |
|---|---|
| PubChem CID | 3428517 |
| Molecular Formula | C23H24N2O2S2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 3-[5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)propanamide |
| SMILES | Cc1ccc(C=C2SC(=S)N(CCC(=O)Nc3c(C)cc(C)cc3C)C2=O)cc1 |
| InChI | InChI=1S/C23H24N2O2S2/c1-14-5-7-18(8-6-14)13-19-22(27)25(23(28)29-19)10-9-20(26)24-21-16(3)11-15(2)12-17(21)4/h5-8,11-13H,9-10H2,1-4H3,(H,24,26) |
| InChIKey | JREFVTUOPYUWED-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|