C21H20N2O2S2 — CID 2856317
N-(3-methylphenyl)-3-[5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide (PubChem CID 2856317) has the molecular formula C21H20N2O2S2 and a molecular weight of 396.54 g/mol. Its IUPAC name is N-(3-methylphenyl)-3-[5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-(3-methylphenyl)-3-[5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 2856317 |
| Molecular Formula | C21H20N2O2S2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-(3-methylphenyl)-3-[5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
| SMILES | Cc1ccc(C=C2SC(=S)N(CCC(=O)Nc3cccc(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C21H20N2O2S2/c1-14-6-8-16(9-7-14)13-18-20(25)23(21(26)27-18)11-10-19(24)22-17-5-3-4-15(2)12-17/h3-9,12-13H,10-11H2,1-2H3,(H,22,24) |
| InChIKey | LDALRVXDLIHNSO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|