C16H15N2O4S2- — CID 7657503
2-[3-[(5E)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]acetate (PubChem CID 7657503) has the molecular formula C16H15N2O4S2- and a molecular weight of 363.44 g/mol. Its IUPAC name is 2-[3-[(5E)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]acetate.
| Compound Name | 2-[3-[(5E)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]acetate |
|---|---|
| PubChem CID | 7657503 |
| Molecular Formula | C16H15N2O4S2- |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 2-[3-[(5E)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]acetate |
| SMILES | Cc1ccc(/C=C2/SC(=S)N(CCC(=O)NCC(=O)[O-])C2=O)cc1 |
| InChI | InChI=1S/C16H16N2O4S2/c1-10-2-4-11(5-3-10)8-12-15(22)18(16(23)24-12)7-6-13(19)17-9-14(20)21/h2-5,8H,6-7,9H2,1H3,(H,17,19)(H,20,21)/p-1/b12-8+ |
| InChIKey | UJYCQLNBKDUCPG-XYOKQWHBSA-M |
| XLogP | 0.45 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|