C24H22ClN3O3S2 — CID 4760386
4-chloro-N'-[4-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyl]benzohydrazide (PubChem CID 4760386) has the molecular formula C24H22ClN3O3S2 and a molecular weight of 500.05 g/mol. Its IUPAC name is 4-chloro-N'-[4-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[4-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyl]benzohydrazide |
|---|---|
| PubChem CID | 4760386 |
| Molecular Formula | C24H22ClN3O3S2 |
| Molecular Weight | 500.05 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | 4-chloro-N'-[4-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyl]benzohydrazide |
| SMILES | CC(=Cc1ccccc1)C=C1SC(=S)N(CCCC(=O)NNC(=O)c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C24H22ClN3O3S2/c1-16(14-17-6-3-2-4-7-17)15-20-23(31)28(24(32)33-20)13-5-8-21(29)26-27-22(30)18-9-11-19(25)12-10-18/h2-4,6-7,9-12,14-15H,5,8,13H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | UDYJDOSFXSKADO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.05 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|