C26H22ClN3O2S3 — CID 2067526
N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide (PubChem CID 2067526) has the molecular formula C26H22ClN3O2S3 and a molecular weight of 540.14 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 2067526 |
| Molecular Formula | C26H22ClN3O2S3 |
| Molecular Weight | 540.14 g/mol |
| Exact Mass | 539.06 |
| IUPAC Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
| SMILES | CC(/C=C1\SC(=S)N(CCCC(=O)Nc2nc(-c3ccc(Cl)cc3)cs2)C1=O)=C\c1ccccc1 |
| InChI | InChI=1S/C26H22ClN3O2S3/c1-17(14-18-6-3-2-4-7-18)15-22-24(32)30(26(33)35-22)13-5-8-23(31)29-25-28-21(16-34-25)19-9-11-20(27)12-10-19/h2-4,6-7,9-12,14-16H,5,8,13H2,1H3,(H,28,29,31)/b17-14+,22-15- |
| InChIKey | RQECDZYMLQEGOK-ZXPGUXPCSA-N |
| XLogP | 7.03 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.14 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|