C24H19N3O2S3 — CID 4760481
2-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 4760481) has the molecular formula C24H19N3O2S3 and a molecular weight of 477.64 g/mol. Its IUPAC name is 2-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-phenyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 4760481 |
| Molecular Formula | C24H19N3O2S3 |
| Molecular Weight | 477.64 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | 2-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CC(=Cc1ccccc1)C=C1SC(=S)N(CC(=O)Nc2nc(-c3ccccc3)cs2)C1=O |
| InChI | InChI=1S/C24H19N3O2S3/c1-16(12-17-8-4-2-5-9-17)13-20-22(29)27(24(30)32-20)14-21(28)26-23-25-19(15-31-23)18-10-6-3-7-11-18/h2-13,15H,14H2,1H3,(H,25,26,28) |
| InChIKey | OIGJUINKAWRZPZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.64 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|