C24H24N2O2S2 — CID 1397228
2-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 1397228) has the molecular formula C24H24N2O2S2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 2-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 1397228 |
| Molecular Formula | C24H24N2O2S2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | CC(=Cc1ccccc1)C=C1SC(=S)N(CC(=O)Nc2c(C)cc(C)cc2C)C1=O |
| InChI | InChI=1S/C24H24N2O2S2/c1-15-10-17(3)22(18(4)11-15)25-21(27)14-26-23(28)20(30-24(26)29)13-16(2)12-19-8-6-5-7-9-19/h5-13H,14H2,1-4H3,(H,25,27) |
| InChIKey | VQZWPIWEDOSQMV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|