C23H22N2O3S — CID 126356722
N-(3,5-dimethylphenyl)-2-[(5E)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126356722) has the molecular formula C23H22N2O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[(5E)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[(5E)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126356722 |
| Molecular Formula | C23H22N2O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[(5E)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | CC(=C\c1ccccc1)/C=C1/SC(=O)N(CC(=O)Nc2cc(C)cc(C)c2)C1=O |
| InChI | InChI=1S/C23H22N2O3S/c1-15-9-16(2)12-19(11-15)24-21(26)14-25-22(27)20(29-23(25)28)13-17(3)10-18-7-5-4-6-8-18/h4-13H,14H2,1-3H3,(H,24,26)/b17-10+,20-13+ |
| InChIKey | VDVLHZROBHOTMS-OOILLMMASA-N |
| XLogP | 4.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|