C21H17ClN2O3S2 — CID 6531725
N-(5-chloro-2-hydroxyphenyl)-2-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide (PubChem CID 6531725) has the molecular formula C21H17ClN2O3S2 and a molecular weight of 444.97 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-2-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-2-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 6531725 |
| Molecular Formula | C21H17ClN2O3S2 |
| Molecular Weight | 444.97 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-2-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide |
| SMILES | CC(/C=C1\SC(=S)N(CC(=O)Nc2cc(Cl)ccc2O)C1=O)=C\c1ccccc1 |
| InChI | InChI=1S/C21H17ClN2O3S2/c1-13(9-14-5-3-2-4-6-14)10-18-20(27)24(21(28)29-18)12-19(26)23-16-11-15(22)7-8-17(16)25/h2-11,25H,12H2,1H3,(H,23,26)/b13-9+,18-10- |
| InChIKey | QPMXUVGATRJLNE-LDFNIPPCSA-N |
| XLogP | 4.83 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.97 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|