C27H24ClN3O2S3 — CID 4760369
N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-4-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide (PubChem CID 4760369) has the molecular formula C27H24ClN3O2S3 and a molecular weight of 554.16 g/mol. Its IUPAC name is N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-4-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-4-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 4760369 |
| Molecular Formula | C27H24ClN3O2S3 |
| Molecular Weight | 554.16 g/mol |
| Exact Mass | 553.07 |
| IUPAC Name | N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-4-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
| SMILES | CC(=Cc1ccccc1)C=C1SC(=S)N(CCCC(=O)Nc2ncc(Cc3ccccc3Cl)s2)C1=O |
| InChI | InChI=1S/C27H24ClN3O2S3/c1-18(14-19-8-3-2-4-9-19)15-23-25(33)31(27(34)36-23)13-7-12-24(32)30-26-29-17-21(35-26)16-20-10-5-6-11-22(20)28/h2-6,8-11,14-15,17H,7,12-13,16H2,1H3,(H,29,30,32) |
| InChIKey | RMPGNFVNCBCSTB-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.16 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|