C26H24ClN3O2S3 — CID 6203281
6-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]hexanamide (PubChem CID 6203281) has the molecular formula C26H24ClN3O2S3 and a molecular weight of 542.15 g/mol. Its IUPAC name is 6-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]hexanamide.
| Compound Name | 6-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]hexanamide |
|---|---|
| PubChem CID | 6203281 |
| Molecular Formula | C26H24ClN3O2S3 |
| Molecular Weight | 542.15 g/mol |
| Exact Mass | 541.07 |
| IUPAC Name | 6-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]hexanamide |
| SMILES | O=C(CCCCCN1C(=O)/C(=C/c2ccccc2)SC1=S)Nc1ncc(Cc2ccccc2Cl)s1 |
| InChI | InChI=1S/C26H24ClN3O2S3/c27-21-12-7-6-11-19(21)16-20-17-28-25(34-20)29-23(31)13-5-2-8-14-30-24(32)22(35-26(30)33)15-18-9-3-1-4-10-18/h1,3-4,6-7,9-12,15,17H,2,5,8,13-14,16H2,(H,28,29,31)/b22-15- |
| InChIKey | RSWALMNEFGHFCV-JCMHNJIXSA-N |
| XLogP | 6.79 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.15 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|