C19H19N3O2S3 — CID 6203272
6-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)hexanamide (PubChem CID 6203272) has the molecular formula C19H19N3O2S3 and a molecular weight of 417.58 g/mol. Its IUPAC name is 6-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)hexanamide.
| Compound Name | 6-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)hexanamide |
|---|---|
| PubChem CID | 6203272 |
| Molecular Formula | C19H19N3O2S3 |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 6-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)/C(=C/c2ccccc2)SC1=S)Nc1nccs1 |
| InChI | InChI=1S/C19H19N3O2S3/c23-16(21-18-20-10-12-26-18)9-5-2-6-11-22-17(24)15(27-19(22)25)13-14-7-3-1-4-8-14/h1,3-4,7-8,10,12-13H,2,5-6,9,11H2,(H,20,21,23)/b15-13- |
| InChIKey | RPANFUAVDBVIDQ-SQFISAMPSA-N |
| XLogP | 4.54 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|