C15H11N3O3S3 — CID 16629482
2-[(5Z)-5-[(4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 16629482) has the molecular formula C15H11N3O3S3 and a molecular weight of 377.47 g/mol. Its IUPAC name is 2-[(5Z)-5-[(4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(5Z)-5-[(4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 16629482 |
| Molecular Formula | C15H11N3O3S3 |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | 2-[(5Z)-5-[(4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)/C(=C/c2ccc(O)cc2)SC1=S)Nc1nccs1 |
| InChI | InChI=1S/C15H11N3O3S3/c19-10-3-1-9(2-4-10)7-11-13(21)18(15(22)24-11)8-12(20)17-14-16-5-6-23-14/h1-7,19H,8H2,(H,16,17,20)/b11-7- |
| InChIKey | AJYVUEXGWUUBJM-XFFZJAGNSA-N |
| XLogP | 2.69 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|