C22H17N3O3S3 — CID 16629491
2-[(5Z)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 16629491) has the molecular formula C22H17N3O3S3 and a molecular weight of 467.60 g/mol. Its IUPAC name is 2-[(5Z)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(5Z)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 16629491 |
| Molecular Formula | C22H17N3O3S3 |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | 2-[(5Z)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)/C(=C/c2cccc(OCc3ccccc3)c2)SC1=S)Nc1nccs1 |
| InChI | InChI=1S/C22H17N3O3S3/c26-19(24-21-23-9-10-30-21)13-25-20(27)18(31-22(25)29)12-16-7-4-8-17(11-16)28-14-15-5-2-1-3-6-15/h1-12H,13-14H2,(H,23,24,26)/b18-12- |
| InChIKey | DKLONDCUUCGPCE-PDGQHHTCSA-N |
| XLogP | 4.56 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|