C29H27FN2O3S2 — CID 16630793
N-(4-fluorophenyl)-6-[(5Z)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide (PubChem CID 16630793) has the molecular formula C29H27FN2O3S2 and a molecular weight of 534.68 g/mol. Its IUPAC name is N-(4-fluorophenyl)-6-[(5Z)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide.
| Compound Name | N-(4-fluorophenyl)-6-[(5Z)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide |
|---|---|
| PubChem CID | 16630793 |
| Molecular Formula | C29H27FN2O3S2 |
| Molecular Weight | 534.68 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | N-(4-fluorophenyl)-6-[(5Z)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide |
| SMILES | O=C(CCCCCN1C(=O)/C(=C/c2cccc(OCc3ccccc3)c2)SC1=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C29H27FN2O3S2/c30-23-13-15-24(16-14-23)31-27(33)12-5-2-6-17-32-28(34)26(37-29(32)36)19-22-10-7-11-25(18-22)35-20-21-8-3-1-4-9-21/h1,3-4,7-11,13-16,18-19H,2,5-6,12,17,20H2,(H,31,33)/b26-19- |
| InChIKey | LWMMDHKRUIIKLI-XHPQRKPJSA-N |
| XLogP | 6.80 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.68 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|