C29H26N2O5S2 — CID 16629783
ethyl 4-[3-[(5Z)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate (PubChem CID 16629783) has the molecular formula C29H26N2O5S2 and a molecular weight of 546.67 g/mol. Its IUPAC name is ethyl 4-[3-[(5Z)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate.
| Compound Name | ethyl 4-[3-[(5Z)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate |
|---|---|
| PubChem CID | 16629783 |
| Molecular Formula | C29H26N2O5S2 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | ethyl 4-[3-[(5Z)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CCN2C(=O)/C(=C/c3cccc(OCc4ccccc4)c3)SC2=S)cc1 |
| InChI | InChI=1S/C29H26N2O5S2/c1-2-35-28(34)22-11-13-23(14-12-22)30-26(32)15-16-31-27(33)25(38-29(31)37)18-21-9-6-10-24(17-21)36-19-20-7-4-3-5-8-20/h3-14,17-18H,2,15-16,19H2,1H3,(H,30,32)/b25-18- |
| InChIKey | RVEWEMBUZLJWSM-BWAHOGKJSA-N |
| XLogP | 5.67 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|