C25H26N2O5S2 — CID 16630543
4-[4-[(5Z)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]butanoic acid (PubChem CID 16630543) has the molecular formula C25H26N2O5S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 4-[4-[(5Z)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]butanoic acid.
| Compound Name | 4-[4-[(5Z)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]butanoic acid |
|---|---|
| PubChem CID | 16630543 |
| Molecular Formula | C25H26N2O5S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 4-[4-[(5Z)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)CCCN1C(=O)/C(=C/c2cccc(OCc3ccccc3)c2)SC1=S |
| InChI | InChI=1S/C25H26N2O5S2/c28-22(26-13-5-12-23(29)30)11-6-14-27-24(31)21(34-25(27)33)16-19-9-4-10-20(15-19)32-17-18-7-2-1-3-8-18/h1-4,7-10,15-16H,5-6,11-14,17H2,(H,26,28)(H,29,30)/b21-16- |
| InChIKey | DECAPJHUOGUCJP-PGMHBOJBSA-N |
| XLogP | 4.23 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|