C19H24N2O3S2 — CID 7344239
N-butyl-4-[(5Z)-5-[(3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide (PubChem CID 7344239) has the molecular formula C19H24N2O3S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is N-butyl-4-[(5Z)-5-[(3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | N-butyl-4-[(5Z)-5-[(3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 7344239 |
| Molecular Formula | C19H24N2O3S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-butyl-4-[(5Z)-5-[(3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
| SMILES | CCCCNC(=O)CCCN1C(=O)/C(=C/c2cccc(OC)c2)SC1=S |
| InChI | InChI=1S/C19H24N2O3S2/c1-3-4-10-20-17(22)9-6-11-21-18(23)16(26-19(21)25)13-14-7-5-8-15(12-14)24-2/h5,7-8,12-13H,3-4,6,9-11H2,1-2H3,(H,20,22)/b16-13- |
| InChIKey | DLZCRSRUECNLQO-SSZFMOIBSA-N |
| XLogP | 3.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|