C21H18Cl2N2O3S2 — CID 4756881
N-(3,5-dichlorophenyl)-4-[5-[(3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide (PubChem CID 4756881) has the molecular formula C21H18Cl2N2O3S2 and a molecular weight of 481.43 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-4-[5-[(3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | N-(3,5-dichlorophenyl)-4-[5-[(3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 4756881 |
| Molecular Formula | C21H18Cl2N2O3S2 |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 480.01 |
| IUPAC Name | N-(3,5-dichlorophenyl)-4-[5-[(3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
| SMILES | COc1cccc(C=C2SC(=S)N(CCCC(=O)Nc3cc(Cl)cc(Cl)c3)C2=O)c1 |
| InChI | InChI=1S/C21H18Cl2N2O3S2/c1-28-17-5-2-4-13(8-17)9-18-20(27)25(21(29)30-18)7-3-6-19(26)24-16-11-14(22)10-15(23)12-16/h2,4-5,8-12H,3,6-7H2,1H3,(H,24,26) |
| InChIKey | DAPJDKGELKHZLV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|