C22H29N3O4S2 — CID 4756939
4-[5-[(3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(3-morpholin-4-ylpropyl)butanamide (PubChem CID 4756939) has the molecular formula C22H29N3O4S2 and a molecular weight of 463.63 g/mol. Its IUPAC name is 4-[5-[(3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(3-morpholin-4-ylpropyl)butanamide.
| Compound Name | 4-[5-[(3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(3-morpholin-4-ylpropyl)butanamide |
|---|---|
| PubChem CID | 4756939 |
| Molecular Formula | C22H29N3O4S2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 4-[5-[(3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(3-morpholin-4-ylpropyl)butanamide |
| SMILES | COc1cccc(C=C2SC(=S)N(CCCC(=O)NCCCN3CCOCC3)C2=O)c1 |
| InChI | InChI=1S/C22H29N3O4S2/c1-28-18-6-2-5-17(15-18)16-19-21(27)25(22(30)31-19)10-3-7-20(26)23-8-4-9-24-11-13-29-14-12-24/h2,5-6,15-16H,3-4,7-14H2,1H3,(H,23,26) |
| InChIKey | AIQKQFGITUYRIQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|