C21H15N3O3S2 — CID 16632434
2-[(5Z)-2,4-dioxo-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 16632434) has the molecular formula C21H15N3O3S2 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-[(5Z)-2,4-dioxo-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(5Z)-2,4-dioxo-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 16632434 |
| Molecular Formula | C21H15N3O3S2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | 2-[(5Z)-2,4-dioxo-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccc(-c3ccccc3)cc2)C1=O)Nc1nccs1 |
| InChI | InChI=1S/C21H15N3O3S2/c25-18(23-20-22-10-11-28-20)13-24-19(26)17(29-21(24)27)12-14-6-8-16(9-7-14)15-4-2-1-3-5-15/h1-12H,13H2,(H,22,23,25)/b17-12- |
| InChIKey | GUDCPXKKXABLMC-ATVHPVEESA-N |
| XLogP | 4.49 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|