C10H7N3O5S2 — CID 5263562
2-[2,4-dioxo-5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethylidene]-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 5263562) has the molecular formula C10H7N3O5S2 and a molecular weight of 313.32 g/mol. Its IUPAC name is 2-[2,4-dioxo-5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethylidene]-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[2,4-dioxo-5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethylidene]-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 5263562 |
| Molecular Formula | C10H7N3O5S2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | 2-[2,4-dioxo-5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethylidene]-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)SC(=CC(=O)Nc2nccs2)C1=O |
| InChI | InChI=1S/C10H7N3O5S2/c14-6(12-9-11-1-2-19-9)3-5-8(17)13(4-7(15)16)10(18)20-5/h1-3H,4H2,(H,15,16)(H,11,12,14) |
| InChIKey | ZOLIGISMDDJLBT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|