C25H23N3O2S3 — CID 1226051
4-(5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]butanamide (PubChem CID 1226051) has the molecular formula C25H23N3O2S3 and a molecular weight of 493.68 g/mol. Its IUPAC name is 4-(5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-(5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 1226051 |
| Molecular Formula | C25H23N3O2S3 |
| Molecular Weight | 493.68 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 4-(5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]butanamide |
| SMILES | Cc1cccc(Cc2cnc(NC(=O)CCCN3C(=O)C(=Cc4ccccc4)SC3=S)s2)c1 |
| InChI | InChI=1S/C25H23N3O2S3/c1-17-7-5-10-19(13-17)14-20-16-26-24(32-20)27-22(29)11-6-12-28-23(30)21(33-25(28)31)15-18-8-3-2-4-9-18/h2-5,7-10,13,15-16H,6,11-12,14H2,1H3,(H,26,27,29) |
| InChIKey | MTMATHVXUPBIHD-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.68 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|