C25H23N3O3S3 — CID 6201751
2-[(5Z)-5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 6201751) has the molecular formula C25H23N3O3S3 and a molecular weight of 509.68 g/mol. Its IUPAC name is 2-[(5Z)-5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[(5Z)-5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 6201751 |
| Molecular Formula | C25H23N3O3S3 |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | 2-[(5Z)-5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CCOc1ccc(/C=C2\SC(=S)N(CC(=O)Nc3ncc(Cc4cccc(C)c4)s3)C2=O)cc1 |
| InChI | InChI=1S/C25H23N3O3S3/c1-3-31-19-9-7-17(8-10-19)13-21-23(30)28(25(32)34-21)15-22(29)27-24-26-14-20(33-24)12-18-6-4-5-16(2)11-18/h4-11,13-14H,3,12,15H2,1-2H3,(H,26,27,29)/b21-13- |
| InChIKey | OTXIMPLUKDHBID-BKUYFWCQSA-N |
| XLogP | 5.28 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|