C20H22N4O3S3 — CID 6201746
N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-[(5Z)-5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide (PubChem CID 6201746) has the molecular formula C20H22N4O3S3 and a molecular weight of 462.62 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-[(5Z)-5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-[(5Z)-5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 6201746 |
| Molecular Formula | C20H22N4O3S3 |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-[(5Z)-5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide |
| SMILES | CCCCc1nnc(NC(=O)CN2C(=O)/C(=C/c3ccc(OCC)cc3)SC2=S)s1 |
| InChI | InChI=1S/C20H22N4O3S3/c1-3-5-6-17-22-23-19(30-17)21-16(25)12-24-18(26)15(29-20(24)28)11-13-7-9-14(10-8-13)27-4-2/h7-11H,3-6,12H2,1-2H3,(H,21,23,25)/b15-11- |
| InChIKey | IGMODCJUJJWIAQ-PTNGSMBKSA-N |
| XLogP | 4.12 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|