C19H19ClN4O2S3 — CID 6391593
N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-[(5E)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide (PubChem CID 6391593) has the molecular formula C19H19ClN4O2S3 and a molecular weight of 467.04 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-[(5E)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-[(5E)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 6391593 |
| Molecular Formula | C19H19ClN4O2S3 |
| Molecular Weight | 467.04 g/mol |
| Exact Mass | 466.04 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-[(5E)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
| SMILES | CCCCc1nnc(NC(=O)CCN2C(=O)/C(=C\c3ccc(Cl)cc3)SC2=S)s1 |
| InChI | InChI=1S/C19H19ClN4O2S3/c1-2-3-4-16-22-23-18(29-16)21-15(25)9-10-24-17(26)14(28-19(24)27)11-12-5-7-13(20)8-6-12/h5-8,11H,2-4,9-10H2,1H3,(H,21,23,25)/b14-11+ |
| InChIKey | XAIJBQMKDJUXJC-SDNWHVSQSA-N |
| XLogP | 4.76 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.04 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|