C18H18N4O2S3 — CID 2872859
2-(5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-(5-butyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 2872859) has the molecular formula C18H18N4O2S3 and a molecular weight of 418.57 g/mol. Its IUPAC name is 2-(5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-(5-butyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-(5-butyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 2872859 |
| Molecular Formula | C18H18N4O2S3 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 2-(5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-(5-butyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCCCc1nnc(NC(=O)CN2C(=O)C(=Cc3ccccc3)SC2=S)s1 |
| InChI | InChI=1S/C18H18N4O2S3/c1-2-3-9-15-20-21-17(27-15)19-14(23)11-22-16(24)13(26-18(22)25)10-12-7-5-4-6-8-12/h4-8,10H,2-3,9,11H2,1H3,(H,19,21,23) |
| InChIKey | CTLQZEGMFHNWLM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|