C19H20N4O5S3 — CID 2886284
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetamide (PubChem CID 2886284) has the molecular formula C19H20N4O5S3 and a molecular weight of 480.59 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 2886284 |
| Molecular Formula | C19H20N4O5S3 |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetamide |
| SMILES | CCc1nnc(NC(=O)CN2C(=O)C(=Cc3cc(OC)c(OC)c(OC)c3)SC2=S)s1 |
| InChI | InChI=1S/C19H20N4O5S3/c1-5-15-21-22-18(31-15)20-14(24)9-23-17(25)13(30-19(23)29)8-10-6-11(26-2)16(28-4)12(7-10)27-3/h6-8H,5,9H2,1-4H3,(H,20,22,24) |
| InChIKey | IEHHDBRSIMPCEF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|