C19H20N4O4S3 — CID 2912497
4-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 2912497) has the molecular formula C19H20N4O4S3 and a molecular weight of 464.59 g/mol. Its IUPAC name is 4-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 4-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 2912497 |
| Molecular Formula | C19H20N4O4S3 |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 4-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | COc1ccc(C=C2SC(=S)N(CCCC(=O)Nc3nnc(C)s3)C2=O)cc1OC |
| InChI | InChI=1S/C19H20N4O4S3/c1-11-21-22-18(29-11)20-16(24)5-4-8-23-17(25)15(30-19(23)28)10-12-6-7-13(26-2)14(9-12)27-3/h6-7,9-10H,4-5,8H2,1-3H3,(H,20,22,24) |
| InChIKey | AXKPTYHLGPHOPG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|