C17H15ClN4O2S3 — CID 6387157
4-[(5E)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 6387157) has the molecular formula C17H15ClN4O2S3 and a molecular weight of 438.99 g/mol. Its IUPAC name is 4-[(5E)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 4-[(5E)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 6387157 |
| Molecular Formula | C17H15ClN4O2S3 |
| Molecular Weight | 438.99 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | 4-[(5E)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | Cc1nnc(NC(=O)CCCN2C(=O)/C(=C\c3ccc(Cl)cc3)SC2=S)s1 |
| InChI | InChI=1S/C17H15ClN4O2S3/c1-10-20-21-16(26-10)19-14(23)3-2-8-22-15(24)13(27-17(22)25)9-11-4-6-12(18)7-5-11/h4-7,9H,2-3,8H2,1H3,(H,19,21,23)/b13-9+ |
| InChIKey | XMWHCCDUURLXPW-UKTHLTGXSA-N |
| XLogP | 4.12 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.99 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|