C26H23Cl2N3O2S3 — CID 6387894
6-[(5E)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]hexanamide (PubChem CID 6387894) has the molecular formula C26H23Cl2N3O2S3 and a molecular weight of 576.60 g/mol. Its IUPAC name is 6-[(5E)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]hexanamide.
| Compound Name | 6-[(5E)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]hexanamide |
|---|---|
| PubChem CID | 6387894 |
| Molecular Formula | C26H23Cl2N3O2S3 |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 575.03 |
| IUPAC Name | 6-[(5E)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]hexanamide |
| SMILES | O=C(CCCCCN1C(=O)/C(=C\c2ccc(Cl)cc2)SC1=S)Nc1ncc(Cc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C26H23Cl2N3O2S3/c27-19-9-5-17(6-10-19)14-21-16-29-25(35-21)30-23(32)4-2-1-3-13-31-24(33)22(36-26(31)34)15-18-7-11-20(28)12-8-18/h5-12,15-16H,1-4,13-14H2,(H,29,30,32)/b22-15+ |
| InChIKey | JBUUVLNAPKNDNU-PXLXIMEGSA-N |
| XLogP | 7.44 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|