C28H26F3N3O3S3 — CID 4759125
6-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]hexanamide (PubChem CID 4759125) has the molecular formula C28H26F3N3O3S3 and a molecular weight of 605.73 g/mol. Its IUPAC name is 6-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]hexanamide.
| Compound Name | 6-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]hexanamide |
|---|---|
| PubChem CID | 4759125 |
| Molecular Formula | C28H26F3N3O3S3 |
| Molecular Weight | 605.73 g/mol |
| Exact Mass | 605.11 |
| IUPAC Name | 6-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]hexanamide |
| SMILES | COc1ccc(C=C2SC(=S)N(CCCCCC(=O)Nc3ncc(Cc4cccc(C(F)(F)F)c4)s3)C2=O)cc1 |
| InChI | InChI=1S/C28H26F3N3O3S3/c1-37-21-11-9-18(10-12-21)16-23-25(36)34(27(38)40-23)13-4-2-3-8-24(35)33-26-32-17-22(39-26)15-19-6-5-7-20(14-19)28(29,30)31/h5-7,9-12,14,16-17H,2-4,8,13,15H2,1H3,(H,32,33,35) |
| InChIKey | UMHWKEICRQFAJL-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.73 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|