C27H26ClN3O3S3 — CID 6203529
N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-6-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide (PubChem CID 6203529) has the molecular formula C27H26ClN3O3S3 and a molecular weight of 572.18 g/mol. Its IUPAC name is N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-6-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide.
| Compound Name | N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-6-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide |
|---|---|
| PubChem CID | 6203529 |
| Molecular Formula | C27H26ClN3O3S3 |
| Molecular Weight | 572.18 g/mol |
| Exact Mass | 571.08 |
| IUPAC Name | N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-6-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanamide |
| SMILES | COc1ccc(/C=C2\SC(=S)N(CCCCCC(=O)Nc3ncc(Cc4ccc(Cl)cc4)s3)C2=O)cc1 |
| InChI | InChI=1S/C27H26ClN3O3S3/c1-34-21-12-8-19(9-13-21)16-23-25(33)31(27(35)37-23)14-4-2-3-5-24(32)30-26-29-17-22(36-26)15-18-6-10-20(28)11-7-18/h6-13,16-17H,2-5,14-15H2,1H3,(H,29,30,32)/b23-16- |
| InChIKey | MZFYXWQTCREQLZ-KQWNVCNZSA-N |
| XLogP | 6.80 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.18 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|