C28H29N3O3S3 — CID 3109910
6-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]hexanamide (PubChem CID 3109910) has the molecular formula C28H29N3O3S3 and a molecular weight of 551.76 g/mol. Its IUPAC name is 6-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]hexanamide.
| Compound Name | 6-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]hexanamide |
|---|---|
| PubChem CID | 3109910 |
| Molecular Formula | C28H29N3O3S3 |
| Molecular Weight | 551.76 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | 6-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]hexanamide |
| SMILES | COc1ccc(C=C2SC(=S)N(CCCCCC(=O)Nc3ncc(Cc4cccc(C)c4)s3)C2=O)cc1 |
| InChI | InChI=1S/C28H29N3O3S3/c1-19-7-6-8-21(15-19)16-23-18-29-27(36-23)30-25(32)9-4-3-5-14-31-26(33)24(37-28(31)35)17-20-10-12-22(34-2)13-11-20/h6-8,10-13,15,17-18H,3-5,9,14,16H2,1-2H3,(H,29,30,32) |
| InChIKey | VJPAUCDDGKGXHY-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.76 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|