C26H23N3O2S3 — CID 4760159
3-(5-cinnamylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]propanamide (PubChem CID 4760159) has the molecular formula C26H23N3O2S3 and a molecular weight of 505.69 g/mol. Its IUPAC name is 3-(5-cinnamylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-(5-cinnamylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 4760159 |
| Molecular Formula | C26H23N3O2S3 |
| Molecular Weight | 505.69 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 3-(5-cinnamylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]propanamide |
| SMILES | Cc1cccc(Cc2cnc(NC(=O)CCN3C(=O)C(=CC=Cc4ccccc4)SC3=S)s2)c1 |
| InChI | InChI=1S/C26H23N3O2S3/c1-18-7-5-11-20(15-18)16-21-17-27-25(33-21)28-23(30)13-14-29-24(31)22(34-26(29)32)12-6-10-19-8-3-2-4-9-19/h2-12,15,17H,13-14,16H2,1H3,(H,27,28,30) |
| InChIKey | YLNUKBMDRRETSL-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.69 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|