C25H21N3O2S3 — CID 6387960
N-[5-[(4-methylphenyl)methyl]-1,3-thiazol-2-yl]-2-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide (PubChem CID 6387960) has the molecular formula C25H21N3O2S3 and a molecular weight of 491.66 g/mol. Its IUPAC name is N-[5-[(4-methylphenyl)methyl]-1,3-thiazol-2-yl]-2-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-[5-[(4-methylphenyl)methyl]-1,3-thiazol-2-yl]-2-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 6387960 |
| Molecular Formula | C25H21N3O2S3 |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | N-[5-[(4-methylphenyl)methyl]-1,3-thiazol-2-yl]-2-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide |
| SMILES | Cc1ccc(Cc2cnc(NC(=O)CN3C(=O)/C(=C/C=C/c4ccccc4)SC3=S)s2)cc1 |
| InChI | InChI=1S/C25H21N3O2S3/c1-17-10-12-19(13-11-17)14-20-15-26-24(32-20)27-22(29)16-28-23(30)21(33-25(28)31)9-5-8-18-6-3-2-4-7-18/h2-13,15H,14,16H2,1H3,(H,26,27,29)/b8-5+,21-9- |
| InChIKey | UYMVASYSLSREHG-IITPSFRQSA-N |
| XLogP | 5.44 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|