C23H19N3O3S3 — CID 3118359
N-(5-benzyl-1,3-thiazol-2-yl)-2-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide (PubChem CID 3118359) has the molecular formula C23H19N3O3S3 and a molecular weight of 481.62 g/mol. Its IUPAC name is N-(5-benzyl-1,3-thiazol-2-yl)-2-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(5-benzyl-1,3-thiazol-2-yl)-2-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 3118359 |
| Molecular Formula | C23H19N3O3S3 |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | N-(5-benzyl-1,3-thiazol-2-yl)-2-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide |
| SMILES | COc1ccc(C=C2SC(=S)N(CC(=O)Nc3ncc(Cc4ccccc4)s3)C2=O)cc1 |
| InChI | InChI=1S/C23H19N3O3S3/c1-29-17-9-7-16(8-10-17)12-19-21(28)26(23(30)32-19)14-20(27)25-22-24-13-18(31-22)11-15-5-3-2-4-6-15/h2-10,12-13H,11,14H2,1H3,(H,24,25,27) |
| InChIKey | ZVCJWZWYNOCILC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|