C19H21N3O2S3 — CID 17033829
4-(5-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]butanamide (PubChem CID 17033829) has the molecular formula C19H21N3O2S3 and a molecular weight of 419.60 g/mol. Its IUPAC name is 4-(5-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-(5-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 17033829 |
| Molecular Formula | C19H21N3O2S3 |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 4-(5-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]butanamide |
| SMILES | Cc1cccc(Cc2cnc(NC(=O)CCCN3C(=O)C(C)SC3=S)s2)c1 |
| InChI | InChI=1S/C19H21N3O2S3/c1-12-5-3-6-14(9-12)10-15-11-20-18(27-15)21-16(23)7-4-8-22-17(24)13(2)26-19(22)25/h3,5-6,9,11,13H,4,7-8,10H2,1-2H3,(H,20,21,23) |
| InChIKey | MJSGARDLDNOWGR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|