C21H25N3O2S3 — CID 17033923
4-(5-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(4-ethylphenyl)methyl]-1,3-thiazol-2-yl]butanamide (PubChem CID 17033923) has the molecular formula C21H25N3O2S3 and a molecular weight of 447.65 g/mol. Its IUPAC name is 4-(5-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(4-ethylphenyl)methyl]-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-(5-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(4-ethylphenyl)methyl]-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 17033923 |
| Molecular Formula | C21H25N3O2S3 |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 4-(5-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(4-ethylphenyl)methyl]-1,3-thiazol-2-yl]butanamide |
| SMILES | CCc1ccc(Cc2cnc(NC(=O)CCCN3C(=O)C(CC)SC3=S)s2)cc1 |
| InChI | InChI=1S/C21H25N3O2S3/c1-3-14-7-9-15(10-8-14)12-16-13-22-20(28-16)23-18(25)6-5-11-24-19(26)17(4-2)29-21(24)27/h7-10,13,17H,3-6,11-12H2,1-2H3,(H,22,23,25) |
| InChIKey | OJNMRGKGBXOPEI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|