C18H18FN3O2S3 — CID 17033669
3-(5-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]propanamide (PubChem CID 17033669) has the molecular formula C18H18FN3O2S3 and a molecular weight of 423.56 g/mol. Its IUPAC name is 3-(5-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-(5-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 17033669 |
| Molecular Formula | C18H18FN3O2S3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 3-(5-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]propanamide |
| SMILES | CCC1SC(=S)N(CCC(=O)Nc2ncc(Cc3ccc(F)cc3)s2)C1=O |
| InChI | InChI=1S/C18H18FN3O2S3/c1-2-14-16(24)22(18(25)27-14)8-7-15(23)21-17-20-10-13(26-17)9-11-3-5-12(19)6-4-11/h3-6,10,14H,2,7-9H2,1H3,(H,20,21,23) |
| InChIKey | PDTOAWACSKXYEX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|