C16H15N3O2S3 — CID 17033490
N-(5-benzyl-1,3-thiazol-2-yl)-2-(5-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetamide (PubChem CID 17033490) has the molecular formula C16H15N3O2S3 and a molecular weight of 377.52 g/mol. Its IUPAC name is N-(5-benzyl-1,3-thiazol-2-yl)-2-(5-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetamide.
| Compound Name | N-(5-benzyl-1,3-thiazol-2-yl)-2-(5-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 17033490 |
| Molecular Formula | C16H15N3O2S3 |
| Molecular Weight | 377.52 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | N-(5-benzyl-1,3-thiazol-2-yl)-2-(5-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetamide |
| SMILES | CC1SC(=S)N(CC(=O)Nc2ncc(Cc3ccccc3)s2)C1=O |
| InChI | InChI=1S/C16H15N3O2S3/c1-10-14(21)19(16(22)23-10)9-13(20)18-15-17-8-12(24-15)7-11-5-3-2-4-6-11/h2-6,8,10H,7,9H2,1H3,(H,17,18,20) |
| InChIKey | CUODEUCOGIKLDI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|